C30H35NO2 — CID 170706641
4-(dimethoxymethyl)-1-[4-[(1R,2S)-2-phenyl-1,2,3,4-tetrahydronaphthalen-1-yl]phenyl]piperidine (PubChem CID 170706641) has the molecular formula C30H35NO2 and a molecular weight of 441.62 g/mol. Its IUPAC name is 4-(dimethoxymethyl)-1-[4-[(1R,2S)-2-phenyl-1,2,3,4-tetrahydronaphthalen-1-yl]phenyl]piperidine.
| Compound Name | 4-(dimethoxymethyl)-1-[4-[(1R,2S)-2-phenyl-1,2,3,4-tetrahydronaphthalen-1-yl]phenyl]piperidine |
|---|---|
| PubChem CID | 170706641 |
| Molecular Formula | C30H35NO2 |
| Molecular Weight | 441.62 g/mol |
| Exact Mass | 441.27 |
| IUPAC Name | 4-(dimethoxymethyl)-1-[4-[(1R,2S)-2-phenyl-1,2,3,4-tetrahydronaphthalen-1-yl]phenyl]piperidine |
| SMILES | COC(OC)C1CCN(c2ccc([C@@H]3c4ccccc4CC[C@@H]3c3ccccc3)cc2)CC1 |
| InChI | InChI=1S/C30H35NO2/c1-32-30(33-2)25-18-20-31(21-19-25)26-15-12-24(13-16-26)29-27-11-7-6-10-23(27)14-17-28(29)22-8-4-3-5-9-22/h3-13,15-16,25,28-30H,14,17-21H2,1-2H3/t28-,29-/m1/s1 |
| InChIKey | VWOKDZUTMMYHLH-FQLXRVMXSA-N |
| XLogP | 6.38 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.62 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|