C32H37NO3 — CID 170706311
(5S,6R)-6-(2-bicyclo[4.2.0]octa-1(6),2,4-trienyl)-5-[4-[4-(dimethoxymethyl)piperidin-1-yl]phenyl]-5,6,7,8-tetrahydronaphthalen-2-ol (PubChem CID 170706311) has the molecular formula C32H37NO3 and a molecular weight of 483.65 g/mol. Its IUPAC name is (5S,6R)-6-(2-bicyclo[4.2.0]octa-1(6),2,4-trienyl)-5-[4-[4-(dimethoxymethyl)piperidin-1-yl]phenyl]-5,6,7,8-tetrahydronaphthalen-2-ol.
| Compound Name | (5S,6R)-6-(2-bicyclo[4.2.0]octa-1(6),2,4-trienyl)-5-[4-[4-(dimethoxymethyl)piperidin-1-yl]phenyl]-5,6,7,8-tetrahydronaphthalen-2-ol |
|---|---|
| PubChem CID | 170706311 |
| Molecular Formula | C32H37NO3 |
| Molecular Weight | 483.65 g/mol |
| Exact Mass | 483.28 |
| IUPAC Name | (5S,6R)-6-(2-bicyclo[4.2.0]octa-1(6),2,4-trienyl)-5-[4-[4-(dimethoxymethyl)piperidin-1-yl]phenyl]-5,6,7,8-tetrahydronaphthalen-2-ol |
| SMILES | COC(OC)C1CCN(c2ccc([C@H]3c4ccc(O)cc4CC[C@H]3c3cccc4c3CC4)cc2)CC1 |
| InChI | InChI=1S/C32H37NO3/c1-35-32(36-2)23-16-18-33(19-17-23)25-10-6-22(7-11-25)31-28-15-12-26(34)20-24(28)9-14-30(31)29-5-3-4-21-8-13-27(21)29/h3-7,10-12,15,20,23,30-32,34H,8-9,13-14,16-19H2,1-2H3/t30-,31-/m0/s1 |
| InChIKey | YEJMZUUXBNVANF-CONSDPRKSA-N |
| XLogP | 6.19 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.65 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|