C26H35NO3 — CID 170706494
(5S,6R)-5-[4-[4-(dimethoxymethyl)piperidin-1-yl]phenyl]-6-ethyl-5,6,7,8-tetrahydronaphthalen-2-ol (PubChem CID 170706494) has the molecular formula C26H35NO3 and a molecular weight of 409.57 g/mol. Its IUPAC name is (5S,6R)-5-[4-[4-(dimethoxymethyl)piperidin-1-yl]phenyl]-6-ethyl-5,6,7,8-tetrahydronaphthalen-2-ol.
| Compound Name | (5S,6R)-5-[4-[4-(dimethoxymethyl)piperidin-1-yl]phenyl]-6-ethyl-5,6,7,8-tetrahydronaphthalen-2-ol |
|---|---|
| PubChem CID | 170706494 |
| Molecular Formula | C26H35NO3 |
| Molecular Weight | 409.57 g/mol |
| Exact Mass | 409.26 |
| IUPAC Name | (5S,6R)-5-[4-[4-(dimethoxymethyl)piperidin-1-yl]phenyl]-6-ethyl-5,6,7,8-tetrahydronaphthalen-2-ol |
| SMILES | CC[C@@H]1CCc2cc(O)ccc2[C@@H]1c1ccc(N2CCC(C(OC)OC)CC2)cc1 |
| InChI | InChI=1S/C26H35NO3/c1-4-18-5-6-21-17-23(28)11-12-24(21)25(18)19-7-9-22(10-8-19)27-15-13-20(14-16-27)26(29-2)30-3/h7-12,17-18,20,25-26,28H,4-6,13-16H2,1-3H3/t18-,25+/m1/s1 |
| InChIKey | FBIIJBYDNDXDKA-CJAUYULYSA-N |
| XLogP | 5.33 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.57 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|