C35H43NO3 — CID 171059035
2-[(5R,6R)-6-(cyclobutylmethyl)-5-[4-[4-(dimethoxymethyl)piperidin-1-yl]phenyl]-5,6,7,8-tetrahydronaphthalen-2-yl]phenol (PubChem CID 171059035) has the molecular formula C35H43NO3 and a molecular weight of 525.73 g/mol. Its IUPAC name is 2-[(5R,6R)-6-(cyclobutylmethyl)-5-[4-[4-(dimethoxymethyl)piperidin-1-yl]phenyl]-5,6,7,8-tetrahydronaphthalen-2-yl]phenol.
| Compound Name | 2-[(5R,6R)-6-(cyclobutylmethyl)-5-[4-[4-(dimethoxymethyl)piperidin-1-yl]phenyl]-5,6,7,8-tetrahydronaphthalen-2-yl]phenol |
|---|---|
| PubChem CID | 171059035 |
| Molecular Formula | C35H43NO3 |
| Molecular Weight | 525.73 g/mol |
| Exact Mass | 525.32 |
| IUPAC Name | 2-[(5R,6R)-6-(cyclobutylmethyl)-5-[4-[4-(dimethoxymethyl)piperidin-1-yl]phenyl]-5,6,7,8-tetrahydronaphthalen-2-yl]phenol |
| SMILES | COC(OC)C1CCN(c2ccc([C@@H]3c4ccc(-c5ccccc5O)cc4CC[C@@H]3CC3CCC3)cc2)CC1 |
| InChI | InChI=1S/C35H43NO3/c1-38-35(39-2)26-18-20-36(21-19-26)30-15-12-25(13-16-30)34-29(22-24-6-5-7-24)11-10-28-23-27(14-17-32(28)34)31-8-3-4-9-33(31)37/h3-4,8-9,12-17,23-24,26,29,34-35,37H,5-7,10-11,18-22H2,1-2H3/t29-,34+/m1/s1 |
| InChIKey | UIGKPYSBJPLXRJ-SJHOIFEDSA-N |
| XLogP | 7.78 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.73 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|