C34H41NO3 — CID 171059029
2-[(5R,6R)-6-(cyclopropylmethyl)-5-[4-[4-(dimethoxymethyl)piperidin-1-yl]phenyl]-5,6,7,8-tetrahydronaphthalen-2-yl]phenol (PubChem CID 171059029) has the molecular formula C34H41NO3 and a molecular weight of 511.71 g/mol. Its IUPAC name is 2-[(5R,6R)-6-(cyclopropylmethyl)-5-[4-[4-(dimethoxymethyl)piperidin-1-yl]phenyl]-5,6,7,8-tetrahydronaphthalen-2-yl]phenol.
| Compound Name | 2-[(5R,6R)-6-(cyclopropylmethyl)-5-[4-[4-(dimethoxymethyl)piperidin-1-yl]phenyl]-5,6,7,8-tetrahydronaphthalen-2-yl]phenol |
|---|---|
| PubChem CID | 171059029 |
| Molecular Formula | C34H41NO3 |
| Molecular Weight | 511.71 g/mol |
| Exact Mass | 511.31 |
| IUPAC Name | 2-[(5R,6R)-6-(cyclopropylmethyl)-5-[4-[4-(dimethoxymethyl)piperidin-1-yl]phenyl]-5,6,7,8-tetrahydronaphthalen-2-yl]phenol |
| SMILES | COC(OC)C1CCN(c2ccc([C@@H]3c4ccc(-c5ccccc5O)cc4CC[C@@H]3CC3CC3)cc2)CC1 |
| InChI | InChI=1S/C34H41NO3/c1-37-34(38-2)25-17-19-35(20-18-25)29-14-11-24(12-15-29)33-28(21-23-7-8-23)10-9-27-22-26(13-16-31(27)33)30-5-3-4-6-32(30)36/h3-6,11-16,22-23,25,28,33-34,36H,7-10,17-21H2,1-2H3/t28-,33+/m1/s1 |
| InChIKey | JLVBEVIKRXIUOG-YDYNHKSESA-N |
| XLogP | 7.39 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.71 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|