C30H39F2NO3 — CID 170649255
(5R,6R)-6-(4,4-difluorocyclohexyl)-5-[4-[4-(dimethoxymethyl)piperidin-1-yl]phenyl]-5,6,7,8-tetrahydronaphthalen-2-ol (PubChem CID 170649255) has the molecular formula C30H39F2NO3 and a molecular weight of 499.64 g/mol. Its IUPAC name is (5R,6R)-6-(4,4-difluorocyclohexyl)-5-[4-[4-(dimethoxymethyl)piperidin-1-yl]phenyl]-5,6,7,8-tetrahydronaphthalen-2-ol.
| Compound Name | (5R,6R)-6-(4,4-difluorocyclohexyl)-5-[4-[4-(dimethoxymethyl)piperidin-1-yl]phenyl]-5,6,7,8-tetrahydronaphthalen-2-ol |
|---|---|
| PubChem CID | 170649255 |
| Molecular Formula | C30H39F2NO3 |
| Molecular Weight | 499.64 g/mol |
| Exact Mass | 499.29 |
| IUPAC Name | (5R,6R)-6-(4,4-difluorocyclohexyl)-5-[4-[4-(dimethoxymethyl)piperidin-1-yl]phenyl]-5,6,7,8-tetrahydronaphthalen-2-ol |
| SMILES | COC(OC)C1CCN(c2ccc([C@@H]3c4ccc(O)cc4CC[C@@H]3C3CCC(F)(F)CC3)cc2)CC1 |
| InChI | InChI=1S/C30H39F2NO3/c1-35-29(36-2)22-13-17-33(18-14-22)24-6-3-21(4-7-24)28-26(20-11-15-30(31,32)16-12-20)9-5-23-19-25(34)8-10-27(23)28/h3-4,6-8,10,19-20,22,26,28-29,34H,5,9,11-18H2,1-2H3/t26-,28+/m1/s1 |
| InChIKey | OSKCPTIZFVQZTH-IAPPQJPRSA-N |
| XLogP | 6.75 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.64 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|