C29H37F2NO3 — CID 170706029
6-(1-cyclopropylethyl)-5-[4-[4-(dimethoxymethyl)piperidin-1-yl]phenyl]-8,8-difluoro-6,7-dihydro-5H-naphthalen-2-ol (PubChem CID 170706029) has the molecular formula C29H37F2NO3 and a molecular weight of 485.62 g/mol. Its IUPAC name is 6-(1-cyclopropylethyl)-5-[4-[4-(dimethoxymethyl)piperidin-1-yl]phenyl]-8,8-difluoro-6,7-dihydro-5H-naphthalen-2-ol.
| Compound Name | 6-(1-cyclopropylethyl)-5-[4-[4-(dimethoxymethyl)piperidin-1-yl]phenyl]-8,8-difluoro-6,7-dihydro-5H-naphthalen-2-ol |
|---|---|
| PubChem CID | 170706029 |
| Molecular Formula | C29H37F2NO3 |
| Molecular Weight | 485.62 g/mol |
| Exact Mass | 485.27 |
| IUPAC Name | 6-(1-cyclopropylethyl)-5-[4-[4-(dimethoxymethyl)piperidin-1-yl]phenyl]-8,8-difluoro-6,7-dihydro-5H-naphthalen-2-ol |
| SMILES | COC(OC)C1CCN(c2ccc(C3c4ccc(O)cc4C(F)(F)CC3C(C)C3CC3)cc2)CC1 |
| InChI | InChI=1S/C29H37F2NO3/c1-18(19-4-5-19)25-17-29(30,31)26-16-23(33)10-11-24(26)27(25)20-6-8-22(9-7-20)32-14-12-21(13-15-32)28(34-2)35-3/h6-11,16,18-19,21,25,27-28,33H,4-5,12-15,17H2,1-3H3 |
| InChIKey | AIHNVPHMVZWGER-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.62 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|