C24H31NO3 — CID 170706271
(5S)-5-[4-[4-(dimethoxymethyl)piperidin-1-yl]phenyl]-5,6,7,8-tetrahydronaphthalen-2-ol (PubChem CID 170706271) has the molecular formula C24H31NO3 and a molecular weight of 381.52 g/mol. Its IUPAC name is (5S)-5-[4-[4-(dimethoxymethyl)piperidin-1-yl]phenyl]-5,6,7,8-tetrahydronaphthalen-2-ol.
| Compound Name | (5S)-5-[4-[4-(dimethoxymethyl)piperidin-1-yl]phenyl]-5,6,7,8-tetrahydronaphthalen-2-ol |
|---|---|
| PubChem CID | 170706271 |
| Molecular Formula | C24H31NO3 |
| Molecular Weight | 381.52 g/mol |
| Exact Mass | 381.23 |
| IUPAC Name | (5S)-5-[4-[4-(dimethoxymethyl)piperidin-1-yl]phenyl]-5,6,7,8-tetrahydronaphthalen-2-ol |
| SMILES | COC(OC)C1CCN(c2ccc([C@@H]3CCCc4cc(O)ccc43)cc2)CC1 |
| InChI | InChI=1S/C24H31NO3/c1-27-24(28-2)18-12-14-25(15-13-18)20-8-6-17(7-9-20)22-5-3-4-19-16-21(26)10-11-23(19)22/h6-11,16,18,22,24,26H,3-5,12-15H2,1-2H3/t22-/m0/s1 |
| InChIKey | IEKIIEFZYONHLW-QFIPXVFZSA-N |
| XLogP | 4.70 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.52 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|