C31H43NO4 — CID 170707056
(5R,6S)-6-cyclohexyl-5-[4-[4-(dimethoxymethyl)piperidin-1-yl]-2-methoxyphenyl]-5,6,7,8-tetrahydronaphthalen-2-ol (PubChem CID 170707056) has the molecular formula C31H43NO4 and a molecular weight of 493.69 g/mol. Its IUPAC name is (5R,6S)-6-cyclohexyl-5-[4-[4-(dimethoxymethyl)piperidin-1-yl]-2-methoxyphenyl]-5,6,7,8-tetrahydronaphthalen-2-ol.
| Compound Name | (5R,6S)-6-cyclohexyl-5-[4-[4-(dimethoxymethyl)piperidin-1-yl]-2-methoxyphenyl]-5,6,7,8-tetrahydronaphthalen-2-ol |
|---|---|
| PubChem CID | 170707056 |
| Molecular Formula | C31H43NO4 |
| Molecular Weight | 493.69 g/mol |
| Exact Mass | 493.32 |
| IUPAC Name | (5R,6S)-6-cyclohexyl-5-[4-[4-(dimethoxymethyl)piperidin-1-yl]-2-methoxyphenyl]-5,6,7,8-tetrahydronaphthalen-2-ol |
| SMILES | COc1cc(N2CCC(C(OC)OC)CC2)ccc1[C@H]1c2ccc(O)cc2CC[C@H]1C1CCCCC1 |
| InChI | InChI=1S/C31H43NO4/c1-34-29-20-24(32-17-15-22(16-18-32)31(35-2)36-3)10-13-28(29)30-26(21-7-5-4-6-8-21)12-9-23-19-25(33)11-14-27(23)30/h10-11,13-14,19-22,26,30-31,33H,4-9,12,15-18H2,1-3H3/t26-,30+/m0/s1 |
| InChIKey | UOOVFNLSKAVRSE-FREGXXQWSA-N |
| XLogP | 6.51 |
| TPSA | 51.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.69 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|