C31H41F2NO3 — CID 170706069
1-[4-(2-cyclohexyl-6-methoxy-1,2,3,4-tetrahydronaphthalen-1-yl)-3,5-difluorophenyl]-4-(dimethoxymethyl)piperidine (PubChem CID 170706069) has the molecular formula C31H41F2NO3 and a molecular weight of 513.67 g/mol. Its IUPAC name is 1-[4-(2-cyclohexyl-6-methoxy-1,2,3,4-tetrahydronaphthalen-1-yl)-3,5-difluorophenyl]-4-(dimethoxymethyl)piperidine.
| Compound Name | 1-[4-(2-cyclohexyl-6-methoxy-1,2,3,4-tetrahydronaphthalen-1-yl)-3,5-difluorophenyl]-4-(dimethoxymethyl)piperidine |
|---|---|
| PubChem CID | 170706069 |
| Molecular Formula | C31H41F2NO3 |
| Molecular Weight | 513.67 g/mol |
| Exact Mass | 513.31 |
| IUPAC Name | 1-[4-(2-cyclohexyl-6-methoxy-1,2,3,4-tetrahydronaphthalen-1-yl)-3,5-difluorophenyl]-4-(dimethoxymethyl)piperidine |
| SMILES | COc1ccc2c(c1)CCC(C1CCCCC1)C2c1c(F)cc(N2CCC(C(OC)OC)CC2)cc1F |
| InChI | InChI=1S/C31H41F2NO3/c1-35-24-10-12-26-22(17-24)9-11-25(20-7-5-4-6-8-20)29(26)30-27(32)18-23(19-28(30)33)34-15-13-21(14-16-34)31(36-2)37-3/h10,12,17-21,25,29,31H,4-9,11,13-16H2,1-3H3 |
| InChIKey | ORCVTPJXQZUTDM-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.67 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|