C30H31NO2 — CID 170706213
1-[4-[(1S,2R)-2-(2-bicyclo[4.2.0]octa-1(6),2,4-trienyl)-6-hydroxy-1,2,3,4-tetrahydronaphthalen-1-yl]phenyl]piperidine-4-carbaldehyde (PubChem CID 170706213) has the molecular formula C30H31NO2 and a molecular weight of 437.58 g/mol. Its IUPAC name is 1-[4-[(1S,2R)-2-(2-bicyclo[4.2.0]octa-1(6),2,4-trienyl)-6-hydroxy-1,2,3,4-tetrahydronaphthalen-1-yl]phenyl]piperidine-4-carbaldehyde.
| Compound Name | 1-[4-[(1S,2R)-2-(2-bicyclo[4.2.0]octa-1(6),2,4-trienyl)-6-hydroxy-1,2,3,4-tetrahydronaphthalen-1-yl]phenyl]piperidine-4-carbaldehyde |
|---|---|
| PubChem CID | 170706213 |
| Molecular Formula | C30H31NO2 |
| Molecular Weight | 437.58 g/mol |
| Exact Mass | 437.24 |
| IUPAC Name | 1-[4-[(1S,2R)-2-(2-bicyclo[4.2.0]octa-1(6),2,4-trienyl)-6-hydroxy-1,2,3,4-tetrahydronaphthalen-1-yl]phenyl]piperidine-4-carbaldehyde |
| SMILES | O=CC1CCN(c2ccc([C@H]3c4ccc(O)cc4CC[C@H]3c3cccc4c3CC4)cc2)CC1 |
| InChI | InChI=1S/C30H31NO2/c32-19-20-14-16-31(17-15-20)24-8-4-22(5-9-24)30-27-13-10-25(33)18-23(27)7-12-29(30)28-3-1-2-21-6-11-26(21)28/h1-5,8-10,13,18-20,29-30,33H,6-7,11-12,14-17H2/t29-,30-/m0/s1 |
| InChIKey | WYDRQRKKUYIGKQ-KYJUHHDHSA-N |
| XLogP | 5.77 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.58 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|