C29H28F3NO — CID 170707109
1-[4-[(1R,2S)-2-phenyl-6-(trifluoromethyl)-1,2,3,4-tetrahydronaphthalen-1-yl]phenyl]piperidine-4-carbaldehyde (PubChem CID 170707109) has the molecular formula C29H28F3NO and a molecular weight of 463.54 g/mol. Its IUPAC name is 1-[4-[(1R,2S)-2-phenyl-6-(trifluoromethyl)-1,2,3,4-tetrahydronaphthalen-1-yl]phenyl]piperidine-4-carbaldehyde.
| Compound Name | 1-[4-[(1R,2S)-2-phenyl-6-(trifluoromethyl)-1,2,3,4-tetrahydronaphthalen-1-yl]phenyl]piperidine-4-carbaldehyde |
|---|---|
| PubChem CID | 170707109 |
| Molecular Formula | C29H28F3NO |
| Molecular Weight | 463.54 g/mol |
| Exact Mass | 463.21 |
| IUPAC Name | 1-[4-[(1R,2S)-2-phenyl-6-(trifluoromethyl)-1,2,3,4-tetrahydronaphthalen-1-yl]phenyl]piperidine-4-carbaldehyde |
| SMILES | O=CC1CCN(c2ccc([C@@H]3c4ccc(C(F)(F)F)cc4CC[C@@H]3c3ccccc3)cc2)CC1 |
| InChI | InChI=1S/C29H28F3NO/c30-29(31,32)24-9-13-27-23(18-24)8-12-26(21-4-2-1-3-5-21)28(27)22-6-10-25(11-7-22)33-16-14-20(19-34)15-17-33/h1-7,9-11,13,18-20,26,28H,8,12,14-17H2/t26-,28+/m1/s1 |
| InChIKey | PZPXJGFDLWVVTE-IAPPQJPRSA-N |
| XLogP | 6.98 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.54 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|