C28H29NO2 — CID 170706344
1-[4-[(1R,2S)-6-hydroxy-2-(2,3,4,5,6-pentadeuteriophenyl)-1,2,3,4-tetrahydronaphthalen-1-yl]phenyl]piperidine-4-carbaldehyde (PubChem CID 170706344) has the molecular formula C28H29NO2 and a molecular weight of 416.58 g/mol. Its IUPAC name is 1-[4-[(1R,2S)-6-hydroxy-2-(2,3,4,5,6-pentadeuteriophenyl)-1,2,3,4-tetrahydronaphthalen-1-yl]phenyl]piperidine-4-carbaldehyde.
| Compound Name | 1-[4-[(1R,2S)-6-hydroxy-2-(2,3,4,5,6-pentadeuteriophenyl)-1,2,3,4-tetrahydronaphthalen-1-yl]phenyl]piperidine-4-carbaldehyde |
|---|---|
| PubChem CID | 170706344 |
| Molecular Formula | C28H29NO2 |
| Molecular Weight | 416.58 g/mol |
| Exact Mass | 416.25 |
| IUPAC Name | 1-[4-[(1R,2S)-6-hydroxy-2-(2,3,4,5,6-pentadeuteriophenyl)-1,2,3,4-tetrahydronaphthalen-1-yl]phenyl]piperidine-4-carbaldehyde |
| SMILES | [2H]c1c([2H])c([2H])c([C@H]2CCc3cc(O)ccc3[C@H]2c2ccc(N3CCC(C=O)CC3)cc2)c([2H])c1[2H] |
| InChI | InChI=1S/C28H29NO2/c30-19-20-14-16-29(17-15-20)24-9-6-22(7-10-24)28-26(21-4-2-1-3-5-21)12-8-23-18-25(31)11-13-27(23)28/h1-7,9-11,13,18-20,26,28,31H,8,12,14-17H2/t26-,28+/m1/s1/i1D,2D,3D,4D,5D |
| InChIKey | HBVWNGLPWPNYME-HBBBUWRGSA-N |
| XLogP | 5.67 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.58 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|