C29H33NO2 — CID 142368214
1-[4-[2-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-6-hydroxy-1,2,3,4-tetrahydronaphthalen-1-yl]phenyl]piperidine-4-carbaldehyde (PubChem CID 142368214) has the molecular formula C29H33NO2 and a molecular weight of 427.59 g/mol. Its IUPAC name is 1-[4-[2-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-6-hydroxy-1,2,3,4-tetrahydronaphthalen-1-yl]phenyl]piperidine-4-carbaldehyde.
| Compound Name | 1-[4-[2-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-6-hydroxy-1,2,3,4-tetrahydronaphthalen-1-yl]phenyl]piperidine-4-carbaldehyde |
|---|---|
| PubChem CID | 142368214 |
| Molecular Formula | C29H33NO2 |
| Molecular Weight | 427.59 g/mol |
| Exact Mass | 427.25 |
| IUPAC Name | 1-[4-[2-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-6-hydroxy-1,2,3,4-tetrahydronaphthalen-1-yl]phenyl]piperidine-4-carbaldehyde |
| SMILES | C=C/C=C(\C=C/C)C1CCc2cc(O)ccc2C1c1ccc(N2CCC(C=O)CC2)cc1 |
| InChI | InChI=1S/C29H33NO2/c1-3-5-22(6-4-2)27-13-9-24-19-26(32)12-14-28(24)29(27)23-7-10-25(11-8-23)30-17-15-21(20-31)16-18-30/h3-8,10-12,14,19-21,27,29,32H,1,9,13,15-18H2,2H3/b6-4-,22-5+ |
| InChIKey | IMAPBMFIFMPCPP-RLNSYGBESA-N |
| XLogP | 6.19 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.59 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|