C23H24O — CID 142090259
(5R,6S)-6-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-5-phenyl-5,6,7,8-tetrahydronaphthalen-2-ol (PubChem CID 142090259) has the molecular formula C23H24O and a molecular weight of 316.44 g/mol. Its IUPAC name is (5R,6S)-6-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-5-phenyl-5,6,7,8-tetrahydronaphthalen-2-ol.
| Compound Name | (5R,6S)-6-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-5-phenyl-5,6,7,8-tetrahydronaphthalen-2-ol |
|---|---|
| PubChem CID | 142090259 |
| Molecular Formula | C23H24O |
| Molecular Weight | 316.44 g/mol |
| Exact Mass | 316.18 |
| IUPAC Name | (5R,6S)-6-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-5-phenyl-5,6,7,8-tetrahydronaphthalen-2-ol |
| SMILES | C=C/C=C(\C=C/C)[C@H]1CCc2cc(O)ccc2[C@H]1c1ccccc1 |
| InChI | InChI=1S/C23H24O/c1-3-8-17(9-4-2)21-14-12-19-16-20(24)13-15-22(19)23(21)18-10-6-5-7-11-18/h3-11,13,15-16,21,23-24H,1,12,14H2,2H3/b9-4-,17-8+/t21-,23+/m1/s1 |
| InChIKey | VGWXVUURDQNTEV-VIHHIWMGSA-N |
| XLogP | 5.78 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.44 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|