C23H24O2 — CID 142068232
5-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-6-(4-hydroxyphenyl)-5,6,7,8-tetrahydronaphthalen-2-ol (PubChem CID 142068232) has the molecular formula C23H24O2 and a molecular weight of 332.44 g/mol. Its IUPAC name is 5-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-6-(4-hydroxyphenyl)-5,6,7,8-tetrahydronaphthalen-2-ol.
| Compound Name | 5-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-6-(4-hydroxyphenyl)-5,6,7,8-tetrahydronaphthalen-2-ol |
|---|---|
| PubChem CID | 142068232 |
| Molecular Formula | C23H24O2 |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.18 |
| IUPAC Name | 5-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-6-(4-hydroxyphenyl)-5,6,7,8-tetrahydronaphthalen-2-ol |
| SMILES | C=C/C=C\C(=C/C)C1c2ccc(O)cc2CCC1c1ccc(O)cc1 |
| InChI | InChI=1S/C23H24O2/c1-3-5-6-16(4-2)23-21(17-7-10-19(24)11-8-17)13-9-18-15-20(25)12-14-22(18)23/h3-8,10-12,14-15,21,23-25H,1,9,13H2,2H3/b6-5-,16-4+ |
| InChIKey | GGPRHJZGFSQFRM-QRHXCOLQSA-N |
| XLogP | 5.60 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|