C34H45BN2O2 — CID 164922888
[5-[4-(9-ethyl-3,9-diazaspiro[5.5]undecan-3-yl)phenyl]-6-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-5,6,7,8-tetrahydronaphthalen-2-yl]boronic acid (PubChem CID 164922888) has the molecular formula C34H45BN2O2 and a molecular weight of 524.56 g/mol. Its IUPAC name is [5-[4-(9-ethyl-3,9-diazaspiro[5.5]undecan-3-yl)phenyl]-6-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-5,6,7,8-tetrahydronaphthalen-2-yl]boronic acid.
| Compound Name | [5-[4-(9-ethyl-3,9-diazaspiro[5.5]undecan-3-yl)phenyl]-6-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-5,6,7,8-tetrahydronaphthalen-2-yl]boronic acid |
|---|---|
| PubChem CID | 164922888 |
| Molecular Formula | C34H45BN2O2 |
| Molecular Weight | 524.56 g/mol |
| Exact Mass | 524.36 |
| IUPAC Name | [5-[4-(9-ethyl-3,9-diazaspiro[5.5]undecan-3-yl)phenyl]-6-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-5,6,7,8-tetrahydronaphthalen-2-yl]boronic acid |
| SMILES | C=C/C=C\C(=C/C)C1CCc2cc(B(O)O)ccc2C1c1ccc(N2CCC3(CCN(CC)CC3)CC2)cc1 |
| InChI | InChI=1S/C34H45BN2O2/c1-4-7-8-26(5-2)31-15-11-28-25-29(35(38)39)12-16-32(28)33(31)27-9-13-30(14-10-27)37-23-19-34(20-24-37)17-21-36(6-3)22-18-34/h4-5,7-10,12-14,16,25,31,33,38-39H,1,6,11,15,17-24H2,2-3H3/b8-7-,26-5+ |
| InChIKey | YJTDZJUBZMILEI-GUYNADSVSA-N |
| XLogP | 5.45 |
| TPSA | 46.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.56 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|