C36H49NO2 — CID 170729428
9-[4-[2-[(2E,4Z)-hepta-2,4-dien-3-yl]-6-[(2-methylpropan-2-yl)oxy]-1,2,3,4-tetrahydronaphthalen-1-yl]phenyl]-1-oxa-9-azaspiro[5.5]undecane (PubChem CID 170729428) has the molecular formula C36H49NO2 and a molecular weight of 527.79 g/mol. Its IUPAC name is 9-[4-[2-[(2E,4Z)-hepta-2,4-dien-3-yl]-6-[(2-methylpropan-2-yl)oxy]-1,2,3,4-tetrahydronaphthalen-1-yl]phenyl]-1-oxa-9-azaspiro[5.5]undecane.
| Compound Name | 9-[4-[2-[(2E,4Z)-hepta-2,4-dien-3-yl]-6-[(2-methylpropan-2-yl)oxy]-1,2,3,4-tetrahydronaphthalen-1-yl]phenyl]-1-oxa-9-azaspiro[5.5]undecane |
|---|---|
| PubChem CID | 170729428 |
| Molecular Formula | C36H49NO2 |
| Molecular Weight | 527.79 g/mol |
| Exact Mass | 527.38 |
| IUPAC Name | 9-[4-[2-[(2E,4Z)-hepta-2,4-dien-3-yl]-6-[(2-methylpropan-2-yl)oxy]-1,2,3,4-tetrahydronaphthalen-1-yl]phenyl]-1-oxa-9-azaspiro[5.5]undecane |
| SMILES | C/C=C(\C=C/CC)C1CCc2cc(OC(C)(C)C)ccc2C1c1ccc(N2CCC3(CCCCO3)CC2)cc1 |
| InChI | InChI=1S/C36H49NO2/c1-6-8-11-27(7-2)32-18-14-29-26-31(39-35(3,4)5)17-19-33(29)34(32)28-12-15-30(16-13-28)37-23-21-36(22-24-37)20-9-10-25-38-36/h7-8,11-13,15-17,19,26,32,34H,6,9-10,14,18,20-25H2,1-5H3/b11-8-,27-7+ |
| InChIKey | XLCHYMWYNIBGTC-FNCDYNFXSA-N |
| XLogP | 9.01 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.79 |
| LogP ≤ 5 | 9.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|