C29H37NO — CID 170729476
(5R,6R)-5-[4-(2-ethyl-7-azaspiro[3.5]nonan-7-yl)phenyl]-6-[(E)-prop-1-enyl]-5,6,7,8-tetrahydronaphthalen-2-ol (PubChem CID 170729476) has the molecular formula C29H37NO and a molecular weight of 415.62 g/mol. Its IUPAC name is (5R,6R)-5-[4-(2-ethyl-7-azaspiro[3.5]nonan-7-yl)phenyl]-6-[(E)-prop-1-enyl]-5,6,7,8-tetrahydronaphthalen-2-ol.
| Compound Name | (5R,6R)-5-[4-(2-ethyl-7-azaspiro[3.5]nonan-7-yl)phenyl]-6-[(E)-prop-1-enyl]-5,6,7,8-tetrahydronaphthalen-2-ol |
|---|---|
| PubChem CID | 170729476 |
| Molecular Formula | C29H37NO |
| Molecular Weight | 415.62 g/mol |
| Exact Mass | 415.29 |
| IUPAC Name | (5R,6R)-5-[4-(2-ethyl-7-azaspiro[3.5]nonan-7-yl)phenyl]-6-[(E)-prop-1-enyl]-5,6,7,8-tetrahydronaphthalen-2-ol |
| SMILES | C/C=C/[C@H]1CCc2cc(O)ccc2[C@H]1c1ccc(N2CCC3(CC2)CC(CC)C3)cc1 |
| InChI | InChI=1S/C29H37NO/c1-3-5-22-6-7-24-18-26(31)12-13-27(24)28(22)23-8-10-25(11-9-23)30-16-14-29(15-17-30)19-21(4-2)20-29/h3,5,8-13,18,21-22,28,31H,4,6-7,14-17,19-20H2,1-2H3/b5-3+/t22-,28+/m0/s1 |
| InChIKey | XOLLWRGEIUCWTI-LSYAVGSVSA-N |
| XLogP | 7.07 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.62 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|