C27H32N2O — CID 164923268
5-[4-(2,6-diazaspiro[3.3]heptan-2-yl)phenyl]-6-[(2E,4Z)-hexa-2,4-dien-3-yl]-5,6,7,8-tetrahydronaphthalen-2-ol (PubChem CID 164923268) has the molecular formula C27H32N2O and a molecular weight of 400.57 g/mol. Its IUPAC name is 5-[4-(2,6-diazaspiro[3.3]heptan-2-yl)phenyl]-6-[(2E,4Z)-hexa-2,4-dien-3-yl]-5,6,7,8-tetrahydronaphthalen-2-ol.
| Compound Name | 5-[4-(2,6-diazaspiro[3.3]heptan-2-yl)phenyl]-6-[(2E,4Z)-hexa-2,4-dien-3-yl]-5,6,7,8-tetrahydronaphthalen-2-ol |
|---|---|
| PubChem CID | 164923268 |
| Molecular Formula | C27H32N2O |
| Molecular Weight | 400.57 g/mol |
| Exact Mass | 400.25 |
| IUPAC Name | 5-[4-(2,6-diazaspiro[3.3]heptan-2-yl)phenyl]-6-[(2E,4Z)-hexa-2,4-dien-3-yl]-5,6,7,8-tetrahydronaphthalen-2-ol |
| SMILES | C/C=C\C(=C/C)C1CCc2cc(O)ccc2C1c1ccc(N2CC3(CNC3)C2)cc1 |
| InChI | InChI=1S/C27H32N2O/c1-3-5-19(4-2)24-12-8-21-14-23(30)11-13-25(21)26(24)20-6-9-22(10-7-20)29-17-27(18-29)15-28-16-27/h3-7,9-11,13-14,24,26,28,30H,8,12,15-18H2,1-2H3/b5-3-,19-4+ |
| InChIKey | OOSPVJGTJOKVGU-UFQSSNLUSA-N |
| XLogP | 5.02 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.57 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|