C26H33IO2S — CID 177319518
ethane;2-[[6-[(2E,4Z)-hexa-2,4-dien-3-yl]-5-(4-hydroxyphenyl)-5,6,7,8-tetrahydronaphthalen-2-yl]oxy]ethyl thiohypoiodite (PubChem CID 177319518) has the molecular formula C26H33IO2S and a molecular weight of 536.52 g/mol. Its IUPAC name is ethane;2-[[6-[(2E,4Z)-hexa-2,4-dien-3-yl]-5-(4-hydroxyphenyl)-5,6,7,8-tetrahydronaphthalen-2-yl]oxy]ethyl thiohypoiodite.
| Compound Name | ethane;2-[[6-[(2E,4Z)-hexa-2,4-dien-3-yl]-5-(4-hydroxyphenyl)-5,6,7,8-tetrahydronaphthalen-2-yl]oxy]ethyl thiohypoiodite |
|---|---|
| PubChem CID | 177319518 |
| Molecular Formula | C26H33IO2S |
| Molecular Weight | 536.52 g/mol |
| Exact Mass | 536.12 |
| IUPAC Name | ethane;2-[[6-[(2E,4Z)-hexa-2,4-dien-3-yl]-5-(4-hydroxyphenyl)-5,6,7,8-tetrahydronaphthalen-2-yl]oxy]ethyl thiohypoiodite |
| SMILES | C/C=C\C(=C/C)C1CCc2cc(OCCSI)ccc2C1c1ccc(O)cc1.CC |
| InChI | InChI=1S/C24H27IO2S.C2H6/c1-3-5-17(4-2)22-12-8-19-16-21(27-14-15-28-25)11-13-23(19)24(22)18-6-9-20(26)10-7-18;1-2/h3-7,9-11,13,16,22,24,26H,8,12,14-15H2,1-2H3;1-2H3/b5-3-,17-4+; |
| InChIKey | GZMFYCBMRCADAH-IEUGSGANSA-N |
| XLogP | 8.10 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.52 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|