C26H26O3 — CID 134582383
4-[4-[(1R,2S)-6-hydroxy-2-phenyl-1,2,3,4-tetrahydronaphthalen-1-yl]phenoxy]butanal (PubChem CID 134582383) has the molecular formula C26H26O3 and a molecular weight of 386.49 g/mol. Its IUPAC name is 4-[4-[(1R,2S)-6-hydroxy-2-phenyl-1,2,3,4-tetrahydronaphthalen-1-yl]phenoxy]butanal.
| Compound Name | 4-[4-[(1R,2S)-6-hydroxy-2-phenyl-1,2,3,4-tetrahydronaphthalen-1-yl]phenoxy]butanal |
|---|---|
| PubChem CID | 134582383 |
| Molecular Formula | C26H26O3 |
| Molecular Weight | 386.49 g/mol |
| Exact Mass | 386.19 |
| IUPAC Name | 4-[4-[(1R,2S)-6-hydroxy-2-phenyl-1,2,3,4-tetrahydronaphthalen-1-yl]phenoxy]butanal |
| SMILES | O=CCCCOc1ccc([C@@H]2c3ccc(O)cc3CC[C@@H]2c2ccccc2)cc1 |
| InChI | InChI=1S/C26H26O3/c27-16-4-5-17-29-23-12-8-20(9-13-23)26-24(19-6-2-1-3-7-19)14-10-21-18-22(28)11-15-25(21)26/h1-3,6-9,11-13,15-16,18,24,26,28H,4-5,10,14,17H2/t24-,26+/m1/s1 |
| InChIKey | KOIDBPAIWISVKZ-RSXGOPAZSA-N |
| XLogP | 5.61 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.49 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|