C45H46N2O5 — CID 167478933
3-[3-[[4-[[4-[4-[(1S,2R)-6-hydroxy-2-phenyl-1,2,3,4-tetrahydronaphthalen-1-yl]phenoxy]butylamino]methyl]phenyl]methoxy]phenyl]piperidine-2,6-dione (PubChem CID 167478933) has the molecular formula C45H46N2O5 and a molecular weight of 694.87 g/mol. Its IUPAC name is 3-[3-[[4-[[4-[4-[(1S,2R)-6-hydroxy-2-phenyl-1,2,3,4-tetrahydronaphthalen-1-yl]phenoxy]butylamino]methyl]phenyl]methoxy]phenyl]piperidine-2,6-dione.
| Compound Name | 3-[3-[[4-[[4-[4-[(1S,2R)-6-hydroxy-2-phenyl-1,2,3,4-tetrahydronaphthalen-1-yl]phenoxy]butylamino]methyl]phenyl]methoxy]phenyl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 167478933 |
| Molecular Formula | C45H46N2O5 |
| Molecular Weight | 694.87 g/mol |
| Exact Mass | 694.34 |
| IUPAC Name | 3-[3-[[4-[[4-[4-[(1S,2R)-6-hydroxy-2-phenyl-1,2,3,4-tetrahydronaphthalen-1-yl]phenoxy]butylamino]methyl]phenyl]methoxy]phenyl]piperidine-2,6-dione |
| SMILES | O=C1CCC(c2cccc(OCc3ccc(CNCCCCOc4ccc([C@H]5c6ccc(O)cc6CC[C@H]5c5ccccc5)cc4)cc3)c2)C(=O)N1 |
| InChI | InChI=1S/C45H46N2O5/c48-37-18-22-41-36(27-37)17-21-40(33-7-2-1-3-8-33)44(41)34-15-19-38(20-16-34)51-26-5-4-25-46-29-31-11-13-32(14-12-31)30-52-39-10-6-9-35(28-39)42-23-24-43(49)47-45(42)50/h1-3,6-16,18-20,22,27-28,40,42,44,46,48H,4-5,17,21,23-26,29-30H2,(H,47,49,50)/t40-,42?,44+/m0/s1 |
| InChIKey | DKAMCJGPDABKHS-XKTFKIQNSA-N |
| XLogP | 8.30 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.87 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|