C29H32N2O4 — CID 167478600
3-[4-[[4-[(4-phenoxybutylamino)methyl]phenyl]methoxy]phenyl]piperidine-2,6-dione (PubChem CID 167478600) has the molecular formula C29H32N2O4 and a molecular weight of 472.59 g/mol. Its IUPAC name is 3-[4-[[4-[(4-phenoxybutylamino)methyl]phenyl]methoxy]phenyl]piperidine-2,6-dione.
| Compound Name | 3-[4-[[4-[(4-phenoxybutylamino)methyl]phenyl]methoxy]phenyl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 167478600 |
| Molecular Formula | C29H32N2O4 |
| Molecular Weight | 472.59 g/mol |
| Exact Mass | 472.24 |
| IUPAC Name | 3-[4-[[4-[(4-phenoxybutylamino)methyl]phenyl]methoxy]phenyl]piperidine-2,6-dione |
| SMILES | O=C1CCC(c2ccc(OCc3ccc(CNCCCCOc4ccccc4)cc3)cc2)C(=O)N1 |
| InChI | InChI=1S/C29H32N2O4/c32-28-17-16-27(29(33)31-28)24-12-14-26(15-13-24)35-21-23-10-8-22(9-11-23)20-30-18-4-5-19-34-25-6-2-1-3-7-25/h1-3,6-15,27,30H,4-5,16-21H2,(H,31,32,33) |
| InChIKey | BQVIKPOZQOJICF-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.59 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|