C19H26ClNO2 — CID 17211513
5-[(4-phenylmethoxyphenyl)methylamino]pentan-1-ol;hydrochloride (PubChem CID 17211513) has the molecular formula C19H26ClNO2 and a molecular weight of 335.88 g/mol. Its IUPAC name is 5-[(4-phenylmethoxyphenyl)methylamino]pentan-1-ol;hydrochloride.
| Compound Name | 5-[(4-phenylmethoxyphenyl)methylamino]pentan-1-ol;hydrochloride |
|---|---|
| PubChem CID | 17211513 |
| Molecular Formula | C19H26ClNO2 |
| Molecular Weight | 335.88 g/mol |
| Exact Mass | 335.17 |
| IUPAC Name | 5-[(4-phenylmethoxyphenyl)methylamino]pentan-1-ol;hydrochloride |
| SMILES | Cl.OCCCCCNCc1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C19H25NO2.ClH/c21-14-6-2-5-13-20-15-17-9-11-19(12-10-17)22-16-18-7-3-1-4-8-18;/h1,3-4,7-12,20-21H,2,5-6,13-16H2;1H |
| InChIKey | BPTNWXUJAYCTOI-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.88 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|