C25H40Cl2N2O — CID 17214463
N',N'-dibutyl-N-[(4-phenylmethoxyphenyl)methyl]propane-1,3-diamine;dihydrochloride (PubChem CID 17214463) has the molecular formula C25H40Cl2N2O and a molecular weight of 455.51 g/mol. Its IUPAC name is N',N'-dibutyl-N-[(4-phenylmethoxyphenyl)methyl]propane-1,3-diamine;dihydrochloride.
| Compound Name | N',N'-dibutyl-N-[(4-phenylmethoxyphenyl)methyl]propane-1,3-diamine;dihydrochloride |
|---|---|
| PubChem CID | 17214463 |
| Molecular Formula | C25H40Cl2N2O |
| Molecular Weight | 455.51 g/mol |
| Exact Mass | 454.25 |
| IUPAC Name | N',N'-dibutyl-N-[(4-phenylmethoxyphenyl)methyl]propane-1,3-diamine;dihydrochloride |
| SMILES | CCCCN(CCCC)CCCNCc1ccc(OCc2ccccc2)cc1.Cl.Cl |
| InChI | InChI=1S/C25H38N2O.2ClH/c1-3-5-18-27(19-6-4-2)20-10-17-26-21-23-13-15-25(16-14-23)28-22-24-11-8-7-9-12-24;;/h7-9,11-16,26H,3-6,10,17-22H2,1-2H3;2*1H |
| InChIKey | AWZLGEQSDZVWTI-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.51 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|