C19H25Cl2NO2 — CID 17211517
5-[[4-[(2-chlorophenyl)methoxy]phenyl]methylamino]pentan-1-ol;hydrochloride (PubChem CID 17211517) has the molecular formula C19H25Cl2NO2 and a molecular weight of 370.32 g/mol. Its IUPAC name is 5-[[4-[(2-chlorophenyl)methoxy]phenyl]methylamino]pentan-1-ol;hydrochloride.
| Compound Name | 5-[[4-[(2-chlorophenyl)methoxy]phenyl]methylamino]pentan-1-ol;hydrochloride |
|---|---|
| PubChem CID | 17211517 |
| Molecular Formula | C19H25Cl2NO2 |
| Molecular Weight | 370.32 g/mol |
| Exact Mass | 369.13 |
| IUPAC Name | 5-[[4-[(2-chlorophenyl)methoxy]phenyl]methylamino]pentan-1-ol;hydrochloride |
| SMILES | Cl.OCCCCCNCc1ccc(OCc2ccccc2Cl)cc1 |
| InChI | InChI=1S/C19H24ClNO2.ClH/c20-19-7-3-2-6-17(19)15-23-18-10-8-16(9-11-18)14-21-12-4-1-5-13-22;/h2-3,6-11,21-22H,1,4-5,12-15H2;1H |
| InChIKey | JLSVYXCYFBDDIH-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.32 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|