C19H27Cl3N2O — CID 17292552
N-[[4-[(2-chlorophenyl)methoxy]phenyl]methyl]-N',N'-dimethylpropane-1,3-diamine;dihydrochloride (PubChem CID 17292552) has the molecular formula C19H27Cl3N2O and a molecular weight of 405.80 g/mol. Its IUPAC name is N-[[4-[(2-chlorophenyl)methoxy]phenyl]methyl]-N',N'-dimethylpropane-1,3-diamine;dihydrochloride.
| Compound Name | N-[[4-[(2-chlorophenyl)methoxy]phenyl]methyl]-N',N'-dimethylpropane-1,3-diamine;dihydrochloride |
|---|---|
| PubChem CID | 17292552 |
| Molecular Formula | C19H27Cl3N2O |
| Molecular Weight | 405.80 g/mol |
| Exact Mass | 404.12 |
| IUPAC Name | N-[[4-[(2-chlorophenyl)methoxy]phenyl]methyl]-N',N'-dimethylpropane-1,3-diamine;dihydrochloride |
| SMILES | CN(C)CCCNCc1ccc(OCc2ccccc2Cl)cc1.Cl.Cl |
| InChI | InChI=1S/C19H25ClN2O.2ClH/c1-22(2)13-5-12-21-14-16-8-10-18(11-9-16)23-15-17-6-3-4-7-19(17)20;;/h3-4,6-11,21H,5,12-15H2,1-2H3;2*1H |
| InChIKey | CSOPXTKCMRCGCI-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.80 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|