C17H23NO3 — CID 172584857
3-(4-hexoxyphenyl)piperidine-2,6-dione (PubChem CID 172584857) has the molecular formula C17H23NO3 and a molecular weight of 289.37 g/mol. Its IUPAC name is 3-(4-hexoxyphenyl)piperidine-2,6-dione.
| Compound Name | 3-(4-hexoxyphenyl)piperidine-2,6-dione |
|---|---|
| PubChem CID | 172584857 |
| Molecular Formula | C17H23NO3 |
| Molecular Weight | 289.37 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | 3-(4-hexoxyphenyl)piperidine-2,6-dione |
| SMILES | CCCCCCOc1ccc(C2CCC(=O)NC2=O)cc1 |
| InChI | InChI=1S/C17H23NO3/c1-2-3-4-5-12-21-14-8-6-13(7-9-14)15-10-11-16(19)18-17(15)20/h6-9,15H,2-5,10-12H2,1H3,(H,18,19,20) |
| InChIKey | JAAYWVACKYCUSZ-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.37 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|