C29H40O2 — CID 70371409
trans-(2R,5S)-5-butyl-2-[4-(4-heptoxyphenyl)phenyl]cyclohexan-1-one (PubChem CID 70371409) has the molecular formula C29H40O2 and a molecular weight of 420.64 g/mol. Its IUPAC name is trans-(2R,5S)-5-butyl-2-[4-(4-heptoxyphenyl)phenyl]cyclohexan-1-one.
| Compound Name | trans-(2R,5S)-5-butyl-2-[4-(4-heptoxyphenyl)phenyl]cyclohexan-1-one |
|---|---|
| PubChem CID | 70371409 |
| Molecular Formula | C29H40O2 |
| Molecular Weight | 420.64 g/mol |
| Exact Mass | 420.30 |
| IUPAC Name | trans-(2R,5S)-5-butyl-2-[4-(4-heptoxyphenyl)phenyl]cyclohexan-1-one |
| SMILES | CCCCCCCOc1ccc(-c2ccc([C@H]3CC[C@H](CCCC)CC3=O)cc2)cc1 |
| InChI | InChI=1S/C29H40O2/c1-3-5-7-8-9-21-31-27-18-16-25(17-19-27)24-12-14-26(15-13-24)28-20-11-23(10-6-4-2)22-29(28)30/h12-19,23,28H,3-11,20-22H2,1-2H3/t23-,28+/m0/s1 |
| InChIKey | PVHYWJFLHYQZAW-NEKDWFFYSA-N |
| XLogP | 8.35 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.64 |
| LogP ≤ 5 | 8.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|