C28H38O — CID 70371365
trans-(2R,5S)-2-[4-(4-heptylphenyl)phenyl]-5-propylcyclohexan-1-one (PubChem CID 70371365) has the molecular formula C28H38O and a molecular weight of 390.61 g/mol. Its IUPAC name is trans-(2R,5S)-2-[4-(4-heptylphenyl)phenyl]-5-propylcyclohexan-1-one.
| Compound Name | trans-(2R,5S)-2-[4-(4-heptylphenyl)phenyl]-5-propylcyclohexan-1-one |
|---|---|
| PubChem CID | 70371365 |
| Molecular Formula | C28H38O |
| Molecular Weight | 390.61 g/mol |
| Exact Mass | 390.29 |
| IUPAC Name | trans-(2R,5S)-2-[4-(4-heptylphenyl)phenyl]-5-propylcyclohexan-1-one |
| SMILES | CCCCCCCc1ccc(-c2ccc([C@H]3CC[C@H](CCC)CC3=O)cc2)cc1 |
| InChI | InChI=1S/C28H38O/c1-3-5-6-7-8-10-22-11-14-24(15-12-22)25-16-18-26(19-17-25)27-20-13-23(9-4-2)21-28(27)29/h11-12,14-19,23,27H,3-10,13,20-21H2,1-2H3/t23-,27+/m0/s1 |
| InChIKey | WMZDFYMQPVZVIY-WNCULLNHSA-N |
| XLogP | 8.12 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.61 |
| LogP ≤ 5 | 8.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|