C25H32O — CID 70371296
trans-(2R,5S)-5-ethyl-2-[4-(4-pentylphenyl)phenyl]cyclohexan-1-one (PubChem CID 70371296) has the molecular formula C25H32O and a molecular weight of 348.53 g/mol. Its IUPAC name is trans-(2R,5S)-5-ethyl-2-[4-(4-pentylphenyl)phenyl]cyclohexan-1-one.
| Compound Name | trans-(2R,5S)-5-ethyl-2-[4-(4-pentylphenyl)phenyl]cyclohexan-1-one |
|---|---|
| PubChem CID | 70371296 |
| Molecular Formula | C25H32O |
| Molecular Weight | 348.53 g/mol |
| Exact Mass | 348.25 |
| IUPAC Name | trans-(2R,5S)-5-ethyl-2-[4-(4-pentylphenyl)phenyl]cyclohexan-1-one |
| SMILES | CCCCCc1ccc(-c2ccc([C@H]3CC[C@H](CC)CC3=O)cc2)cc1 |
| InChI | InChI=1S/C25H32O/c1-3-5-6-7-20-8-11-21(12-9-20)22-13-15-23(16-14-22)24-17-10-19(4-2)18-25(24)26/h8-9,11-16,19,24H,3-7,10,17-18H2,1-2H3/t19-,24+/m0/s1 |
| InChIKey | OATSLINYAOUQOO-YADARESESA-N |
| XLogP | 6.95 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.53 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|