C19H28O — CID 23041151
5-butyl-2-(4-propylphenyl)cyclohexan-1-one (PubChem CID 23041151) has the molecular formula C19H28O and a molecular weight of 272.43 g/mol. Its IUPAC name is 5-butyl-2-(4-propylphenyl)cyclohexan-1-one.
| Compound Name | 5-butyl-2-(4-propylphenyl)cyclohexan-1-one |
|---|---|
| PubChem CID | 23041151 |
| Molecular Formula | C19H28O |
| Molecular Weight | 272.43 g/mol |
| Exact Mass | 272.21 |
| IUPAC Name | 5-butyl-2-(4-propylphenyl)cyclohexan-1-one |
| SMILES | CCCCC1CCC(c2ccc(CCC)cc2)C(=O)C1 |
| InChI | InChI=1S/C19H28O/c1-3-5-7-16-10-13-18(19(20)14-16)17-11-8-15(6-4-2)9-12-17/h8-9,11-12,16,18H,3-7,10,13-14H2,1-2H3 |
| InChIKey | HGIKACYPIRLASN-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.43 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |