C21H32O2 — CID 54311381
trans-(2S,5R)-2-(4-butoxyphenyl)-5-pentylcyclohexan-1-one (PubChem CID 54311381) has the molecular formula C21H32O2 and a molecular weight of 316.49 g/mol. Its IUPAC name is trans-(2S,5R)-2-(4-butoxyphenyl)-5-pentylcyclohexan-1-one.
| Compound Name | trans-(2S,5R)-2-(4-butoxyphenyl)-5-pentylcyclohexan-1-one |
|---|---|
| PubChem CID | 54311381 |
| Molecular Formula | C21H32O2 |
| Molecular Weight | 316.49 g/mol |
| Exact Mass | 316.24 |
| IUPAC Name | trans-(2S,5R)-2-(4-butoxyphenyl)-5-pentylcyclohexan-1-one |
| SMILES | CCCCC[C@@H]1CC[C@@H](c2ccc(OCCCC)cc2)C(=O)C1 |
| InChI | InChI=1S/C21H32O2/c1-3-5-7-8-17-9-14-20(21(22)16-17)18-10-12-19(13-11-18)23-15-6-4-2/h10-13,17,20H,3-9,14-16H2,1-2H3/t17-,20+/m1/s1 |
| InChIKey | SLDGEJOEKXIUPK-XLIONFOSSA-N |
| XLogP | 5.90 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.49 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|