C26H34O2 — CID 70371425
trans-(2R,5S)-2-[4-(4-pentoxyphenyl)phenyl]-5-propylcyclohexan-1-one (PubChem CID 70371425) has the molecular formula C26H34O2 and a molecular weight of 378.56 g/mol. Its IUPAC name is trans-(2R,5S)-2-[4-(4-pentoxyphenyl)phenyl]-5-propylcyclohexan-1-one.
| Compound Name | trans-(2R,5S)-2-[4-(4-pentoxyphenyl)phenyl]-5-propylcyclohexan-1-one |
|---|---|
| PubChem CID | 70371425 |
| Molecular Formula | C26H34O2 |
| Molecular Weight | 378.56 g/mol |
| Exact Mass | 378.26 |
| IUPAC Name | trans-(2R,5S)-2-[4-(4-pentoxyphenyl)phenyl]-5-propylcyclohexan-1-one |
| SMILES | CCCCCOc1ccc(-c2ccc([C@H]3CC[C@H](CCC)CC3=O)cc2)cc1 |
| InChI | InChI=1S/C26H34O2/c1-3-5-6-18-28-24-15-13-22(14-16-24)21-9-11-23(12-10-21)25-17-8-20(7-4-2)19-26(25)27/h9-16,20,25H,3-8,17-19H2,1-2H3/t20-,25+/m0/s1 |
| InChIKey | YBAPMMLYGNJQDP-NBGIEHNGSA-N |
| XLogP | 7.18 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.56 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|