About 2-[2-[4-(2,6-dioxopiperidin-3-yl)phenoxy]ethoxy]ethyl 4-methylbenzenesulfonate
2-[2-[4-(2,6-dioxopiperidin-3-yl)phenoxy]ethoxy]ethyl 4-methylbenzenesulfonate (PubChem CID 174340432) has the molecular formula C22H25NO7S
and a molecular weight of 447.51 g/mol. Its IUPAC name is 2-[2-[4-(2,6-dioxopiperidin-3-yl)phenoxy]ethoxy]ethyl 4-methylbenzenesulfonate.
Molecular Properties
| Compound Name | 2-[2-[4-(2,6-dioxopiperidin-3-yl)phenoxy]ethoxy]ethyl 4-methylbenzenesulfonate |
| PubChem CID | 174340432 |
| Molecular Formula | C22H25NO7S |
| Molecular Weight | 447.51 g/mol |
| Exact Mass | 447.14 |
| IUPAC Name | 2-[2-[4-(2,6-dioxopiperidin-3-yl)phenoxy]ethoxy]ethyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCCOCCOc2ccc(C3CCC(=O)NC3=O)cc2)cc1 |
| InChI | InChI=1S/C22H25NO7S/c1-16-2-8-19(9-3-16)31(26,27)30-15-13-28-12-14-29-18-6-4-17(5-7-18)20-10-11-21(24)23-22(20)25/h2-9,20H,10-15H2,1H3,(H,23,24,25) |
| InChIKey | YMZUSJGUHILFSK-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 447.51 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-[4-(2,6-dioxopiperidin-3-yl)phenoxy]ethoxy]ethyl 4-methylbenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-[4-(2,6-dioxopiperidin-3-yl)phenoxy]ethoxy]ethyl 4-methylbenzenesulfonate?
The IUPAC name of 2-[2-[4-(2,6-dioxopiperidin-3-yl)phenoxy]ethoxy]ethyl 4-methylbenzenesulfonate (CID 174340432) is 2-[2-[4-(2,6-dioxopiperidin-3-yl)phenoxy]ethoxy]ethyl 4-methylbenzenesulfonate.
What is the SMILES notation for 2-[2-[4-(2,6-dioxopiperidin-3-yl)phenoxy]ethoxy]ethyl 4-methylbenzenesulfonate?
The canonical SMILES for 2-[2-[4-(2,6-dioxopiperidin-3-yl)phenoxy]ethoxy]ethyl 4-methylbenzenesulfonate is Cc1ccc(S(=O)(=O)OCCOCCOc2ccc(C3CCC(=O)NC3=O)cc2)cc1.
What is the InChIKey of 2-[2-[4-(2,6-dioxopiperidin-3-yl)phenoxy]ethoxy]ethyl 4-methylbenzenesulfonate?
The InChIKey is YMZUSJGUHILFSK-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H25NO7S/c1-16-2-8-19(9-3-16)31(26,27)30-15-13-28-12-14-29-18-6-4-17(5-7-18)20-10-11-21(24)23-22(20)25/h2-9,20H,10-15H2,1H3,(H,23,24,25).
What are the key properties of 2-[2-[4-(2,6-dioxopiperidin-3-yl)phenoxy]ethoxy]ethyl 4-methylbenzenesulfonate?
2-[2-[4-(2,6-dioxopiperidin-3-yl)phenoxy]ethoxy]ethyl 4-methylbenzenesulfonate has a molecular weight of 447.51 g/mol, XLogP of 2.32, 10 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-[4-(2,6-dioxopiperidin-3-yl)phenoxy]ethoxy]ethyl 4-methylbenzenesulfonate is sourced from PubChem (CID 174340432), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).