C39H44O5 — CID 160912532
tert-butyl 4-[2-[4-[(1S,2R)-2-phenyl-6-phenylmethoxy-1,2,3,4-tetrahydronaphthalen-1-yl]phenoxy]ethoxy]butanoate (PubChem CID 160912532) has the molecular formula C39H44O5 and a molecular weight of 592.78 g/mol. Its IUPAC name is tert-butyl 4-[2-[4-[(1S,2R)-2-phenyl-6-phenylmethoxy-1,2,3,4-tetrahydronaphthalen-1-yl]phenoxy]ethoxy]butanoate.
| Compound Name | tert-butyl 4-[2-[4-[(1S,2R)-2-phenyl-6-phenylmethoxy-1,2,3,4-tetrahydronaphthalen-1-yl]phenoxy]ethoxy]butanoate |
|---|---|
| PubChem CID | 160912532 |
| Molecular Formula | C39H44O5 |
| Molecular Weight | 592.78 g/mol |
| Exact Mass | 592.32 |
| IUPAC Name | tert-butyl 4-[2-[4-[(1S,2R)-2-phenyl-6-phenylmethoxy-1,2,3,4-tetrahydronaphthalen-1-yl]phenoxy]ethoxy]butanoate |
| SMILES | CC(C)(C)OC(=O)CCCOCCOc1ccc([C@H]2c3ccc(OCc4ccccc4)cc3CC[C@H]2c2ccccc2)cc1 |
| InChI | InChI=1S/C39H44O5/c1-39(2,3)44-37(40)15-10-24-41-25-26-42-33-19-16-31(17-20-33)38-35(30-13-8-5-9-14-30)22-18-32-27-34(21-23-36(32)38)43-28-29-11-6-4-7-12-29/h4-9,11-14,16-17,19-21,23,27,35,38H,10,15,18,22,24-26,28H2,1-3H3/t35-,38+/m0/s1 |
| InChIKey | ZQQZAXXFTPUSPQ-ZGAWMTGXSA-N |
| XLogP | 8.64 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.78 |
| LogP ≤ 5 | 8.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|