C31H28O3 — CID 146587686
[4-[(1R)-2-phenyl-6-phenylmethoxy-1,2,3,4-tetrahydronaphthalen-1-yl]phenyl] acetate (PubChem CID 146587686) has the molecular formula C31H28O3 and a molecular weight of 448.56 g/mol. Its IUPAC name is [4-[(1R)-2-phenyl-6-phenylmethoxy-1,2,3,4-tetrahydronaphthalen-1-yl]phenyl] acetate.
| Compound Name | [4-[(1R)-2-phenyl-6-phenylmethoxy-1,2,3,4-tetrahydronaphthalen-1-yl]phenyl] acetate |
|---|---|
| PubChem CID | 146587686 |
| Molecular Formula | C31H28O3 |
| Molecular Weight | 448.56 g/mol |
| Exact Mass | 448.20 |
| IUPAC Name | [4-[(1R)-2-phenyl-6-phenylmethoxy-1,2,3,4-tetrahydronaphthalen-1-yl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccc([C@@H]2c3ccc(OCc4ccccc4)cc3CCC2c2ccccc2)cc1 |
| InChI | InChI=1S/C31H28O3/c1-22(32)34-27-15-12-25(13-16-27)31-29(24-10-6-3-7-11-24)18-14-26-20-28(17-19-30(26)31)33-21-23-8-4-2-5-9-23/h2-13,15-17,19-20,29,31H,14,18,21H2,1H3/t29?,31-/m0/s1 |
| InChIKey | AJNLYRZWWUJQIS-RDFOUATCSA-N |
| XLogP | 7.05 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.56 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|