C37H35FO3 — CID 134580043
5-[4-[(1R,2S)-2-(4-fluorophenyl)-6-phenylmethoxy-1,2,3,4-tetrahydronaphthalen-1-yl]phenoxy]-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-one (PubChem CID 134580043) has the molecular formula C37H35FO3 and a molecular weight of 546.68 g/mol. Its IUPAC name is 5-[4-[(1R,2S)-2-(4-fluorophenyl)-6-phenylmethoxy-1,2,3,4-tetrahydronaphthalen-1-yl]phenoxy]-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-one.
| Compound Name | 5-[4-[(1R,2S)-2-(4-fluorophenyl)-6-phenylmethoxy-1,2,3,4-tetrahydronaphthalen-1-yl]phenoxy]-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-one |
|---|---|
| PubChem CID | 134580043 |
| Molecular Formula | C37H35FO3 |
| Molecular Weight | 546.68 g/mol |
| Exact Mass | 546.26 |
| IUPAC Name | 5-[4-[(1R,2S)-2-(4-fluorophenyl)-6-phenylmethoxy-1,2,3,4-tetrahydronaphthalen-1-yl]phenoxy]-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-one |
| SMILES | O=C1CC2CC(Oc3ccc([C@@H]4c5ccc(OCc6ccccc6)cc5CC[C@@H]4c4ccc(F)cc4)cc3)CC2C1 |
| InChI | InChI=1S/C37H35FO3/c38-30-11-6-25(7-12-30)35-16-10-27-20-33(40-23-24-4-2-1-3-5-24)15-17-36(27)37(35)26-8-13-32(14-9-26)41-34-21-28-18-31(39)19-29(28)22-34/h1-9,11-15,17,20,28-29,34-35,37H,10,16,18-19,21-23H2/t28?,29?,34?,35-,37+/m1/s1 |
| InChIKey | MRNUYTOQWXLYOC-FIWDLDFBSA-N |
| XLogP | 8.40 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.68 |
| LogP ≤ 5 | 8.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |