C33H25F9O4S — CID 142367521
[4-[(2S)-2-phenyl-6-phenylmethoxy-1,2,3,4-tetrahydronaphthalen-1-yl]phenyl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate (PubChem CID 142367521) has the molecular formula C33H25F9O4S and a molecular weight of 688.61 g/mol. Its IUPAC name is [4-[(2S)-2-phenyl-6-phenylmethoxy-1,2,3,4-tetrahydronaphthalen-1-yl]phenyl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate.
| Compound Name | [4-[(2S)-2-phenyl-6-phenylmethoxy-1,2,3,4-tetrahydronaphthalen-1-yl]phenyl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate |
|---|---|
| PubChem CID | 142367521 |
| Molecular Formula | C33H25F9O4S |
| Molecular Weight | 688.61 g/mol |
| Exact Mass | 688.13 |
| IUPAC Name | [4-[(2S)-2-phenyl-6-phenylmethoxy-1,2,3,4-tetrahydronaphthalen-1-yl]phenyl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate |
| SMILES | O=S(=O)(Oc1ccc(C2c3ccc(OCc4ccccc4)cc3CC[C@@H]2c2ccccc2)cc1)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C33H25F9O4S/c34-30(35,32(38,39)40)31(36,37)33(41,42)47(43,44)46-25-14-11-23(12-15-25)29-27(22-9-5-2-6-10-22)17-13-24-19-26(16-18-28(24)29)45-20-21-7-3-1-4-8-21/h1-12,14-16,18-19,27,29H,13,17,20H2/t27-,29?/m1/s1 |
| InChIKey | FIFCQBRBFPOHEZ-SCBLGKRXSA-N |
| XLogP | 9.26 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.61 |
| LogP ≤ 5 | 9.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|