C28H23F9O2S — CID 162134547
(1R,2S)-6-methyl-1-[4-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonylmethyl)phenyl]-2-phenyl-1,2,3,4-tetrahydronaphthalene (PubChem CID 162134547) has the molecular formula C28H23F9O2S and a molecular weight of 594.54 g/mol. Its IUPAC name is (1R,2S)-6-methyl-1-[4-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonylmethyl)phenyl]-2-phenyl-1,2,3,4-tetrahydronaphthalene.
| Compound Name | (1R,2S)-6-methyl-1-[4-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonylmethyl)phenyl]-2-phenyl-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 162134547 |
| Molecular Formula | C28H23F9O2S |
| Molecular Weight | 594.54 g/mol |
| Exact Mass | 594.13 |
| IUPAC Name | (1R,2S)-6-methyl-1-[4-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonylmethyl)phenyl]-2-phenyl-1,2,3,4-tetrahydronaphthalene |
| SMILES | Cc1ccc2c(c1)CC[C@H](c1ccccc1)[C@@H]2c1ccc(CS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C28H23F9O2S/c1-17-7-13-23-21(15-17)12-14-22(19-5-3-2-4-6-19)24(23)20-10-8-18(9-11-20)16-40(38,39)28(36,37)26(31,32)25(29,30)27(33,34)35/h2-11,13,15,22,24H,12,14,16H2,1H3/t22-,24+/m1/s1 |
| InChIKey | RDSFHOLKUBCAGO-VWNXMTODSA-N |
| XLogP | 8.20 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.54 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|