C26H29NO — CID 139330652
(5R,6S)-5-[4-[2-(ethylamino)ethyl]phenyl]-6-phenyl-5,6,7,8-tetrahydronaphthalen-2-ol (PubChem CID 139330652) has the molecular formula C26H29NO and a molecular weight of 371.52 g/mol. Its IUPAC name is (5R,6S)-5-[4-[2-(ethylamino)ethyl]phenyl]-6-phenyl-5,6,7,8-tetrahydronaphthalen-2-ol.
| Compound Name | (5R,6S)-5-[4-[2-(ethylamino)ethyl]phenyl]-6-phenyl-5,6,7,8-tetrahydronaphthalen-2-ol |
|---|---|
| PubChem CID | 139330652 |
| Molecular Formula | C26H29NO |
| Molecular Weight | 371.52 g/mol |
| Exact Mass | 371.22 |
| IUPAC Name | (5R,6S)-5-[4-[2-(ethylamino)ethyl]phenyl]-6-phenyl-5,6,7,8-tetrahydronaphthalen-2-ol |
| SMILES | CCNCCc1ccc([C@@H]2c3ccc(O)cc3CC[C@@H]2c2ccccc2)cc1 |
| InChI | InChI=1S/C26H29NO/c1-2-27-17-16-19-8-10-21(11-9-19)26-24(20-6-4-3-5-7-20)14-12-22-18-23(28)13-15-25(22)26/h3-11,13,15,18,24,26-28H,2,12,14,16-17H2,1H3/t24-,26+/m1/s1 |
| InChIKey | VFTWOGSYKDWUCH-RSXGOPAZSA-N |
| XLogP | 5.41 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.52 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|