C30H37NO — CID 139336500
N-ethyl-2-[4-[(1R,2S)-6-methoxy-2-(4-propan-2-ylphenyl)-1,2,3,4-tetrahydronaphthalen-1-yl]phenyl]ethanamine (PubChem CID 139336500) has the molecular formula C30H37NO and a molecular weight of 427.63 g/mol. Its IUPAC name is N-ethyl-2-[4-[(1R,2S)-6-methoxy-2-(4-propan-2-ylphenyl)-1,2,3,4-tetrahydronaphthalen-1-yl]phenyl]ethanamine.
| Compound Name | N-ethyl-2-[4-[(1R,2S)-6-methoxy-2-(4-propan-2-ylphenyl)-1,2,3,4-tetrahydronaphthalen-1-yl]phenyl]ethanamine |
|---|---|
| PubChem CID | 139336500 |
| Molecular Formula | C30H37NO |
| Molecular Weight | 427.63 g/mol |
| Exact Mass | 427.29 |
| IUPAC Name | N-ethyl-2-[4-[(1R,2S)-6-methoxy-2-(4-propan-2-ylphenyl)-1,2,3,4-tetrahydronaphthalen-1-yl]phenyl]ethanamine |
| SMILES | CCNCCc1ccc([C@@H]2c3ccc(OC)cc3CC[C@@H]2c2ccc(C(C)C)cc2)cc1 |
| InChI | InChI=1S/C30H37NO/c1-5-31-19-18-22-6-8-25(9-7-22)30-28(24-12-10-23(11-13-24)21(2)3)16-14-26-20-27(32-4)15-17-29(26)30/h6-13,15,17,20-21,28,30-31H,5,14,16,18-19H2,1-4H3/t28-,30+/m1/s1 |
| InChIKey | KXVPIBSWTRSPCY-DGPALRBDSA-N |
| XLogP | 6.83 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.63 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|