C31H35NO3 — CID 70149469
(E)-N,N-diethyl-3-[4-[6-methoxy-2-(4-methoxyphenyl)-1,2,3,4-tetrahydronaphthalen-1-yl]phenyl]prop-2-enamide (PubChem CID 70149469) has the molecular formula C31H35NO3 and a molecular weight of 469.63 g/mol. Its IUPAC name is (E)-N,N-diethyl-3-[4-[6-methoxy-2-(4-methoxyphenyl)-1,2,3,4-tetrahydronaphthalen-1-yl]phenyl]prop-2-enamide.
| Compound Name | (E)-N,N-diethyl-3-[4-[6-methoxy-2-(4-methoxyphenyl)-1,2,3,4-tetrahydronaphthalen-1-yl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 70149469 |
| Molecular Formula | C31H35NO3 |
| Molecular Weight | 469.63 g/mol |
| Exact Mass | 469.26 |
| IUPAC Name | (E)-N,N-diethyl-3-[4-[6-methoxy-2-(4-methoxyphenyl)-1,2,3,4-tetrahydronaphthalen-1-yl]phenyl]prop-2-enamide |
| SMILES | CCN(CC)C(=O)/C=C/c1ccc(C2c3ccc(OC)cc3CCC2c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C31H35NO3/c1-5-32(6-2)30(33)20-9-22-7-10-24(11-8-22)31-28(23-12-15-26(34-3)16-13-23)18-14-25-21-27(35-4)17-19-29(25)31/h7-13,15-17,19-21,28,31H,5-6,14,18H2,1-4H3/b20-9+ |
| InChIKey | ZQRKVCZHBUUYLV-AWQFTUOYSA-N |
| XLogP | 6.45 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.63 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|