C31H36O4 — CID 19830764
2-[4-[5-[6-methoxy-2-(4-methoxyphenyl)-1,2,3,4-tetrahydronaphthalen-1-yl]pentyl]phenyl]acetic acid (PubChem CID 19830764) has the molecular formula C31H36O4 and a molecular weight of 472.63 g/mol. Its IUPAC name is 2-[4-[5-[6-methoxy-2-(4-methoxyphenyl)-1,2,3,4-tetrahydronaphthalen-1-yl]pentyl]phenyl]acetic acid.
| Compound Name | 2-[4-[5-[6-methoxy-2-(4-methoxyphenyl)-1,2,3,4-tetrahydronaphthalen-1-yl]pentyl]phenyl]acetic acid |
|---|---|
| PubChem CID | 19830764 |
| Molecular Formula | C31H36O4 |
| Molecular Weight | 472.63 g/mol |
| Exact Mass | 472.26 |
| IUPAC Name | 2-[4-[5-[6-methoxy-2-(4-methoxyphenyl)-1,2,3,4-tetrahydronaphthalen-1-yl]pentyl]phenyl]acetic acid |
| SMILES | COc1ccc(C2CCc3cc(OC)ccc3C2CCCCCc2ccc(CC(=O)O)cc2)cc1 |
| InChI | InChI=1S/C31H36O4/c1-34-26-15-12-24(13-16-26)28-18-14-25-21-27(35-2)17-19-29(25)30(28)7-5-3-4-6-22-8-10-23(11-9-22)20-31(32)33/h8-13,15-17,19,21,28,30H,3-7,14,18,20H2,1-2H3,(H,32,33) |
| InChIKey | STGPLCJZVGEAMX-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.63 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|