C25H38O3 — CID 129084205
methyl 7-[(2S)-2-(4-hexylphenyl)-5-oxocyclopentyl]heptanoate (PubChem CID 129084205) has the molecular formula C25H38O3 and a molecular weight of 386.58 g/mol. Its IUPAC name is methyl 7-[(2S)-2-(4-hexylphenyl)-5-oxocyclopentyl]heptanoate.
| Compound Name | methyl 7-[(2S)-2-(4-hexylphenyl)-5-oxocyclopentyl]heptanoate |
|---|---|
| PubChem CID | 129084205 |
| Molecular Formula | C25H38O3 |
| Molecular Weight | 386.58 g/mol |
| Exact Mass | 386.28 |
| IUPAC Name | methyl 7-[(2S)-2-(4-hexylphenyl)-5-oxocyclopentyl]heptanoate |
| SMILES | CCCCCCc1ccc([C@H]2CCC(=O)C2CCCCCCC(=O)OC)cc1 |
| InChI | InChI=1S/C25H38O3/c1-3-4-5-8-11-20-14-16-21(17-15-20)22-18-19-24(26)23(22)12-9-6-7-10-13-25(27)28-2/h14-17,22-23H,3-13,18-19H2,1-2H3/t22-,23?/m1/s1 |
| InChIKey | DRYGRSWPWVKMAE-WTQRLHSKSA-N |
| XLogP | 6.39 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.58 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|