C24H36O4 — CID 59465600
7-[(1R,2S)-2-[4-(2-hydroxyhexyl)phenyl]-5-oxocyclopentyl]heptanoic acid (PubChem CID 59465600) has the molecular formula C24H36O4 and a molecular weight of 388.55 g/mol. Its IUPAC name is 7-[(1R,2S)-2-[4-(2-hydroxyhexyl)phenyl]-5-oxocyclopentyl]heptanoic acid.
| Compound Name | 7-[(1R,2S)-2-[4-(2-hydroxyhexyl)phenyl]-5-oxocyclopentyl]heptanoic acid |
|---|---|
| PubChem CID | 59465600 |
| Molecular Formula | C24H36O4 |
| Molecular Weight | 388.55 g/mol |
| Exact Mass | 388.26 |
| IUPAC Name | 7-[(1R,2S)-2-[4-(2-hydroxyhexyl)phenyl]-5-oxocyclopentyl]heptanoic acid |
| SMILES | CCCCC(O)Cc1ccc([C@H]2CCC(=O)[C@@H]2CCCCCCC(=O)O)cc1 |
| InChI | InChI=1S/C24H36O4/c1-2-3-8-20(25)17-18-11-13-19(14-12-18)21-15-16-23(26)22(21)9-6-4-5-7-10-24(27)28/h11-14,20-22,25H,2-10,15-17H2,1H3,(H,27,28)/t20?,21-,22-/m1/s1 |
| InChIKey | AFVFPGBVTXFYMQ-HRUVVLKGSA-N |
| XLogP | 5.27 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.55 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|