C25H36O4 — CID 59465580
7-[(1R,2S)-2-[4-[cyclohexyl(hydroxy)methyl]phenyl]-5-oxocyclopentyl]heptanoic acid (PubChem CID 59465580) has the molecular formula C25H36O4 and a molecular weight of 400.56 g/mol. Its IUPAC name is 7-[(1R,2S)-2-[4-[cyclohexyl(hydroxy)methyl]phenyl]-5-oxocyclopentyl]heptanoic acid.
| Compound Name | 7-[(1R,2S)-2-[4-[cyclohexyl(hydroxy)methyl]phenyl]-5-oxocyclopentyl]heptanoic acid |
|---|---|
| PubChem CID | 59465580 |
| Molecular Formula | C25H36O4 |
| Molecular Weight | 400.56 g/mol |
| Exact Mass | 400.26 |
| IUPAC Name | 7-[(1R,2S)-2-[4-[cyclohexyl(hydroxy)methyl]phenyl]-5-oxocyclopentyl]heptanoic acid |
| SMILES | O=C(O)CCCCCC[C@H]1C(=O)CC[C@@H]1c1ccc(C(O)C2CCCCC2)cc1 |
| InChI | InChI=1S/C25H36O4/c26-23-17-16-21(22(23)10-6-1-2-7-11-24(27)28)18-12-14-20(15-13-18)25(29)19-8-4-3-5-9-19/h12-15,19,21-22,25,29H,1-11,16-17H2,(H,27,28)/t21-,22-,25?/m1/s1 |
| InChIKey | FLFZVSDHXMCUKI-QQMHWKEJSA-N |
| XLogP | 5.79 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.56 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|