C24H38O4S — CID 159817119
7-[(1R,2S)-2-[4-[(1S)-1-hydroxyhexyl]phenyl]-5-oxocyclopentyl]heptanoic acid;sulfane (PubChem CID 159817119) has the molecular formula C24H38O4S and a molecular weight of 422.63 g/mol. Its IUPAC name is 7-[(1R,2S)-2-[4-[(1S)-1-hydroxyhexyl]phenyl]-5-oxocyclopentyl]heptanoic acid;sulfane.
| Compound Name | 7-[(1R,2S)-2-[4-[(1S)-1-hydroxyhexyl]phenyl]-5-oxocyclopentyl]heptanoic acid;sulfane |
|---|---|
| PubChem CID | 159817119 |
| Molecular Formula | C24H38O4S |
| Molecular Weight | 422.63 g/mol |
| Exact Mass | 422.25 |
| IUPAC Name | 7-[(1R,2S)-2-[4-[(1S)-1-hydroxyhexyl]phenyl]-5-oxocyclopentyl]heptanoic acid;sulfane |
| SMILES | CCCCC[C@H](O)c1ccc([C@H]2CCC(=O)[C@@H]2CCCCCCC(=O)O)cc1.S |
| InChI | InChI=1S/C24H36O4.H2S/c1-2-3-6-10-22(25)19-14-12-18(13-15-19)20-16-17-23(26)21(20)9-7-4-5-8-11-24(27)28;/h12-15,20-22,25H,2-11,16-17H2,1H3,(H,27,28);1H2/t20-,21-,22+;/m1./s1 |
| InChIKey | NLTDYGJWASLYFD-NAMGLFDPSA-N |
| XLogP | 5.90 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.63 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|