C30H50O4Si — CID 68952094
7-[2-[4-[1-[tert-butyl(dimethyl)silyl]oxyhexyl]phenyl]-5-oxocyclopentyl]heptanoic acid (PubChem CID 68952094) has the molecular formula C30H50O4Si and a molecular weight of 502.81 g/mol. Its IUPAC name is 7-[2-[4-[1-[tert-butyl(dimethyl)silyl]oxyhexyl]phenyl]-5-oxocyclopentyl]heptanoic acid.
| Compound Name | 7-[2-[4-[1-[tert-butyl(dimethyl)silyl]oxyhexyl]phenyl]-5-oxocyclopentyl]heptanoic acid |
|---|---|
| PubChem CID | 68952094 |
| Molecular Formula | C30H50O4Si |
| Molecular Weight | 502.81 g/mol |
| Exact Mass | 502.35 |
| IUPAC Name | 7-[2-[4-[1-[tert-butyl(dimethyl)silyl]oxyhexyl]phenyl]-5-oxocyclopentyl]heptanoic acid |
| SMILES | CCCCCC(O[Si](C)(C)C(C)(C)C)c1ccc(C2CCC(=O)C2CCCCCCC(=O)O)cc1 |
| InChI | InChI=1S/C30H50O4Si/c1-7-8-11-15-28(34-35(5,6)30(2,3)4)24-19-17-23(18-20-24)25-21-22-27(31)26(25)14-12-9-10-13-16-29(32)33/h17-20,25-26,28H,7-16,21-22H2,1-6H3,(H,32,33) |
| InChIKey | IWKJJFJLPWKZEJ-UHFFFAOYSA-N |
| XLogP | 8.82 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.81 |
| LogP ≤ 5 | 8.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|